About (3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1H-pyrrol-3-yl)methanone
(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1H-pyrrol-3-yl)methanone (PubChem CID 131684068) has the molecular formula C14H21N3O
and a molecular weight of 247.34 g/mol. Its IUPAC name is (3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1H-pyrrol-3-yl)methanone.
Molecular Properties
| Compound Name | (3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1H-pyrrol-3-yl)methanone |
| PubChem CID | 131684068 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | (3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1H-pyrrol-3-yl)methanone |
| SMILES | CC(C)N1CC2CCC(C1)N2C(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C14H21N3O/c1-10(2)16-8-12-3-4-13(9-16)17(12)14(18)11-5-6-15-7-11/h5-7,10,12-13,15H,3-4,8-9H2,1-2H3 |
| InChIKey | DWQYAPOQIBDGSO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1H-pyrrol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1H-pyrrol-3-yl)methanone?
The IUPAC name of (3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1H-pyrrol-3-yl)methanone (CID 131684068) is (3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1H-pyrrol-3-yl)methanone.
What is the SMILES notation for (3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1H-pyrrol-3-yl)methanone?
The canonical SMILES for (3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1H-pyrrol-3-yl)methanone is CC(C)N1CC2CCC(C1)N2C(=O)c1cc[nH]c1.
What is the InChIKey of (3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1H-pyrrol-3-yl)methanone?
The InChIKey is DWQYAPOQIBDGSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O/c1-10(2)16-8-12-3-4-13(9-16)17(12)14(18)11-5-6-15-7-11/h5-7,10,12-13,15H,3-4,8-9H2,1-2H3.
What are the key properties of (3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1H-pyrrol-3-yl)methanone?
(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1H-pyrrol-3-yl)methanone has a molecular weight of 247.34 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1H-pyrrol-3-yl)methanone is sourced from PubChem (CID 131684068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).