C16H26OSi — CID 13168420
2,2,3,3,4,4,5-heptamethyl-5-phenyloxasilolane (PubChem CID 13168420) has the molecular formula C16H26OSi and a molecular weight of 262.47 g/mol. Its IUPAC name is 2,2,3,3,4,4,5-heptamethyl-5-phenyloxasilolane.
| Compound Name | 2,2,3,3,4,4,5-heptamethyl-5-phenyloxasilolane |
|---|---|
| PubChem CID | 13168420 |
| Molecular Formula | C16H26OSi |
| Molecular Weight | 262.47 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2,2,3,3,4,4,5-heptamethyl-5-phenyloxasilolane |
| SMILES | CC1(c2ccccc2)O[Si](C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C16H26OSi/c1-14(2)15(3,4)18(6,7)17-16(14,5)13-11-9-8-10-12-13/h8-12H,1-7H3 |
| InChIKey | HLCDATLPBIFRCI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|