C15H21N3O3 — CID 131684250
1-[(4aR,7aR)-4-ethyl-3-oxo-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazine-6-carbonyl]cyclopentane-1-carbonitrile (PubChem CID 131684250) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-[(4aR,7aR)-4-ethyl-3-oxo-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazine-6-carbonyl]cyclopentane-1-carbonitrile.
| Compound Name | 1-[(4aR,7aR)-4-ethyl-3-oxo-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazine-6-carbonyl]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 131684250 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-[(4aR,7aR)-4-ethyl-3-oxo-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazine-6-carbonyl]cyclopentane-1-carbonitrile |
| SMILES | CCN1C(=O)CO[C@@H]2CN(C(=O)C3(C#N)CCCC3)C[C@H]21 |
| InChI | InChI=1S/C15H21N3O3/c1-2-18-11-7-17(8-12(11)21-9-13(18)19)14(20)15(10-16)5-3-4-6-15/h11-12H,2-9H2,1H3/t11-,12-/m1/s1 |
| InChIKey | WBMYLOBZVQKUEM-VXGBXAGGSA-N |
| XLogP | 0.53 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |