C20H32N2O2 — CID 131684368
[8-(3-methylcyclobutanecarbonyl)-8-azaspiro[4.5]decan-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 131684368) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is [8-(3-methylcyclobutanecarbonyl)-8-azaspiro[4.5]decan-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [8-(3-methylcyclobutanecarbonyl)-8-azaspiro[4.5]decan-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 131684368 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | [8-(3-methylcyclobutanecarbonyl)-8-azaspiro[4.5]decan-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CC1CC(C(=O)N2CCC3(CCC(C(=O)N4CCCC4)C3)CC2)C1 |
| InChI | InChI=1S/C20H32N2O2/c1-15-12-17(13-15)19(24)22-10-6-20(7-11-22)5-4-16(14-20)18(23)21-8-2-3-9-21/h15-17H,2-14H2,1H3 |
| InChIKey | HXMPDRFCWLMTKC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |