About [1-(cyclobutylmethyl)-1,8-diazaspiro[4.5]decan-8-yl]-(1-fluorocyclopropyl)methanone
[1-(cyclobutylmethyl)-1,8-diazaspiro[4.5]decan-8-yl]-(1-fluorocyclopropyl)methanone (PubChem CID 131684507) has the molecular formula C17H27FN2O
and a molecular weight of 294.41 g/mol. Its IUPAC name is [1-(cyclobutylmethyl)-1,8-diazaspiro[4.5]decan-8-yl]-(1-fluorocyclopropyl)methanone.
Molecular Properties
| Compound Name | [1-(cyclobutylmethyl)-1,8-diazaspiro[4.5]decan-8-yl]-(1-fluorocyclopropyl)methanone |
| PubChem CID | 131684507 |
| Molecular Formula | C17H27FN2O |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | [1-(cyclobutylmethyl)-1,8-diazaspiro[4.5]decan-8-yl]-(1-fluorocyclopropyl)methanone |
| SMILES | O=C(N1CCC2(CCCN2CC2CCC2)CC1)C1(F)CC1 |
| InChI | InChI=1S/C17H27FN2O/c18-17(6-7-17)15(21)19-11-8-16(9-12-19)5-2-10-20(16)13-14-3-1-4-14/h14H,1-13H2 |
| InChIKey | OFMTTZDTPVTKSR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(cyclobutylmethyl)-1,8-diazaspiro[4.5]decan-8-yl]-(1-fluorocyclopropyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(cyclobutylmethyl)-1,8-diazaspiro[4.5]decan-8-yl]-(1-fluorocyclopropyl)methanone?
The IUPAC name of [1-(cyclobutylmethyl)-1,8-diazaspiro[4.5]decan-8-yl]-(1-fluorocyclopropyl)methanone (CID 131684507) is [1-(cyclobutylmethyl)-1,8-diazaspiro[4.5]decan-8-yl]-(1-fluorocyclopropyl)methanone.
What is the SMILES notation for [1-(cyclobutylmethyl)-1,8-diazaspiro[4.5]decan-8-yl]-(1-fluorocyclopropyl)methanone?
The canonical SMILES for [1-(cyclobutylmethyl)-1,8-diazaspiro[4.5]decan-8-yl]-(1-fluorocyclopropyl)methanone is O=C(N1CCC2(CCCN2CC2CCC2)CC1)C1(F)CC1.
What is the InChIKey of [1-(cyclobutylmethyl)-1,8-diazaspiro[4.5]decan-8-yl]-(1-fluorocyclopropyl)methanone?
The InChIKey is OFMTTZDTPVTKSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27FN2O/c18-17(6-7-17)15(21)19-11-8-16(9-12-19)5-2-10-20(16)13-14-3-1-4-14/h14H,1-13H2.
What are the key properties of [1-(cyclobutylmethyl)-1,8-diazaspiro[4.5]decan-8-yl]-(1-fluorocyclopropyl)methanone?
[1-(cyclobutylmethyl)-1,8-diazaspiro[4.5]decan-8-yl]-(1-fluorocyclopropyl)methanone has a molecular weight of 294.41 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(cyclobutylmethyl)-1,8-diazaspiro[4.5]decan-8-yl]-(1-fluorocyclopropyl)methanone is sourced from PubChem (CID 131684507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).