C13H19FN2O2 — CID 131684957
2-(1-fluorocyclobutanecarbonyl)-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 131684957) has the molecular formula C13H19FN2O2 and a molecular weight of 254.30 g/mol. Its IUPAC name is 2-(1-fluorocyclobutanecarbonyl)-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | 2-(1-fluorocyclobutanecarbonyl)-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 131684957 |
| Molecular Formula | C13H19FN2O2 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 2-(1-fluorocyclobutanecarbonyl)-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | CN1CCC2CN(C(=O)C3(F)CCC3)CC2C1=O |
| InChI | InChI=1S/C13H19FN2O2/c1-15-6-3-9-7-16(8-10(9)11(15)17)12(18)13(14)4-2-5-13/h9-10H,2-8H2,1H3 |
| InChIKey | ZWKVFNSDPXFLPD-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |