C19H27FN4O2 — CID 131684964
[(5aR,9aS)-4-(5-ethylpyrimidin-2-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1-fluorocyclobutyl)methanone (PubChem CID 131684964) has the molecular formula C19H27FN4O2 and a molecular weight of 362.45 g/mol. Its IUPAC name is [(5aR,9aS)-4-(5-ethylpyrimidin-2-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1-fluorocyclobutyl)methanone.
| Compound Name | [(5aR,9aS)-4-(5-ethylpyrimidin-2-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1-fluorocyclobutyl)methanone |
|---|---|
| PubChem CID | 131684964 |
| Molecular Formula | C19H27FN4O2 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [(5aR,9aS)-4-(5-ethylpyrimidin-2-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1-fluorocyclobutyl)methanone |
| SMILES | CCc1cnc(N2CCO[C@@H]3CN(C(=O)C4(F)CCC4)CC[C@@H]3C2)nc1 |
| InChI | InChI=1S/C19H27FN4O2/c1-2-14-10-21-18(22-11-14)24-8-9-26-16-13-23(7-4-15(16)12-24)17(25)19(20)5-3-6-19/h10-11,15-16H,2-9,12-13H2,1H3/t15-,16-/m1/s1 |
| InChIKey | XGSWDHVDQRERJW-HZPDHXFCSA-N |
| XLogP | 1.98 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |