C19H30N2O4 — CID 131684968
[(5aR,9aS)-4-(oxan-4-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-[(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-yl]methanone (PubChem CID 131684968) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is [(5aR,9aS)-4-(oxan-4-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-[(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-yl]methanone.
| Compound Name | [(5aR,9aS)-4-(oxan-4-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-[(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-yl]methanone |
|---|---|
| PubChem CID | 131684968 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | [(5aR,9aS)-4-(oxan-4-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-[(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-yl]methanone |
| SMILES | O=C(C1[C@H]2COC[C@@H]12)N1CC[C@@H]2CN(C3CCOCC3)CCO[C@@H]2C1 |
| InChI | InChI=1S/C19H30N2O4/c22-19(18-15-11-24-12-16(15)18)21-4-1-13-9-20(5-8-25-17(13)10-21)14-2-6-23-7-3-14/h13-18H,1-12H2/t13-,15-,16+,17-,18?/m1/s1 |
| InChIKey | LSEZJUJAHCBRHD-SRKZOOFXSA-N |
| XLogP | 0.61 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |