About barium(2+);bis(2-oxido-1,3,2lambda5-dioxaphospholane 2-oxide)
barium(2+);bis(2-oxido-1,3,2lambda5-dioxaphospholane 2-oxide) (PubChem CID 13168504) has the molecular formula C4H8BaO8P2
and a molecular weight of 383.38 g/mol. Its IUPAC name is barium(2+);bis(2-oxido-1,3,2lambda5-dioxaphospholane 2-oxide).
Molecular Properties
| Compound Name | barium(2+);bis(2-oxido-1,3,2lambda5-dioxaphospholane 2-oxide) |
| PubChem CID | 13168504 |
| Molecular Formula | C4H8BaO8P2 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.87 |
| IUPAC Name | barium(2+);bis(2-oxido-1,3,2lambda5-dioxaphospholane 2-oxide) |
| SMILES | O=P1([O-])OCCO1.O=P1([O-])OCCO1.[Ba+2] |
| InChI | InChI=1S/2C2H5O4P.Ba/c2*3-7(4)5-1-2-6-7;/h2*1-2H2,(H,3,4);/q;;+2/p-2 |
| InChIKey | WYSMYKFMZTZESN-UHFFFAOYSA-L |
| XLogP | -1.38 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);bis(2-oxido-1,3,2lambda5-dioxaphospholane 2-oxide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(2-oxido-1,3,2lambda5-dioxaphospholane 2-oxide)?
The IUPAC name of barium(2+);bis(2-oxido-1,3,2lambda5-dioxaphospholane 2-oxide) (CID 13168504) is barium(2+);bis(2-oxido-1,3,2lambda5-dioxaphospholane 2-oxide).
What is the SMILES notation for barium(2+);bis(2-oxido-1,3,2lambda5-dioxaphospholane 2-oxide)?
The canonical SMILES for barium(2+);bis(2-oxido-1,3,2lambda5-dioxaphospholane 2-oxide) is O=P1([O-])OCCO1.O=P1([O-])OCCO1.[Ba+2].
What is the InChIKey of barium(2+);bis(2-oxido-1,3,2lambda5-dioxaphospholane 2-oxide)?
The InChIKey is WYSMYKFMZTZESN-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H5O4P.Ba/c2*3-7(4)5-1-2-6-7;/h2*1-2H2,(H,3,4);/q;;+2/p-2.
What are the key properties of barium(2+);bis(2-oxido-1,3,2lambda5-dioxaphospholane 2-oxide)?
barium(2+);bis(2-oxido-1,3,2lambda5-dioxaphospholane 2-oxide) has a molecular weight of 383.38 g/mol, XLogP of -1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(2-oxido-1,3,2lambda5-dioxaphospholane 2-oxide) is sourced from PubChem (CID 13168504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).