About (1-fluorocyclobutyl)-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]methanone
(1-fluorocyclobutyl)-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]methanone (PubChem CID 131685187) has the molecular formula C17H24FN3O2S
and a molecular weight of 353.46 g/mol. Its IUPAC name is (1-fluorocyclobutyl)-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]methanone.
Molecular Properties
| Compound Name | (1-fluorocyclobutyl)-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]methanone |
| PubChem CID | 131685187 |
| Molecular Formula | C17H24FN3O2S |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (1-fluorocyclobutyl)-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]methanone |
| SMILES | O=C(N1CCC2(CC1)COCCN(c1nccs1)C2)C1(F)CCC1 |
| InChI | InChI=1S/C17H24FN3O2S/c18-17(2-1-3-17)14(22)20-7-4-16(5-8-20)12-21(9-10-23-13-16)15-19-6-11-24-15/h6,11H,1-5,7-10,12-13H2 |
| InChIKey | SGFZWROLICGHFB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-fluorocyclobutyl)-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-fluorocyclobutyl)-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]methanone?
The IUPAC name of (1-fluorocyclobutyl)-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]methanone (CID 131685187) is (1-fluorocyclobutyl)-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]methanone.
What is the SMILES notation for (1-fluorocyclobutyl)-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]methanone?
The canonical SMILES for (1-fluorocyclobutyl)-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]methanone is O=C(N1CCC2(CC1)COCCN(c1nccs1)C2)C1(F)CCC1.
What is the InChIKey of (1-fluorocyclobutyl)-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]methanone?
The InChIKey is SGFZWROLICGHFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24FN3O2S/c18-17(2-1-3-17)14(22)20-7-4-16(5-8-20)12-21(9-10-23-13-16)15-19-6-11-24-15/h6,11H,1-5,7-10,12-13H2.
What are the key properties of (1-fluorocyclobutyl)-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]methanone?
(1-fluorocyclobutyl)-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]methanone has a molecular weight of 353.46 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-fluorocyclobutyl)-[11-(1,3-thiazol-2-yl)-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl]methanone is sourced from PubChem (CID 131685187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).