C15H20FN7O — CID 131685202
(1-fluorocyclobutyl)-[3-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]methanone (PubChem CID 131685202) has the molecular formula C15H20FN7O and a molecular weight of 333.37 g/mol. Its IUPAC name is (1-fluorocyclobutyl)-[3-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]methanone.
| Compound Name | (1-fluorocyclobutyl)-[3-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]methanone |
|---|---|
| PubChem CID | 131685202 |
| Molecular Formula | C15H20FN7O |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (1-fluorocyclobutyl)-[3-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]methanone |
| SMILES | Cc1cnnn1Cc1nnc2n1CCCN(C(=O)C1(F)CCC1)C2 |
| InChI | InChI=1S/C15H20FN7O/c1-11-8-17-20-23(11)10-13-19-18-12-9-21(6-3-7-22(12)13)14(24)15(16)4-2-5-15/h8H,2-7,9-10H2,1H3 |
| InChIKey | HUECPJDPXQPANK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |