C19H25F3N4O2 — CID 131685566
2-[(1S,3aR,7aR)-5-[6-(trifluoromethyl)pyrimidin-4-yl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-1-piperidin-1-ylethanone (PubChem CID 131685566) has the molecular formula C19H25F3N4O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is 2-[(1S,3aR,7aR)-5-[6-(trifluoromethyl)pyrimidin-4-yl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[(1S,3aR,7aR)-5-[6-(trifluoromethyl)pyrimidin-4-yl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 131685566 |
| Molecular Formula | C19H25F3N4O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2-[(1S,3aR,7aR)-5-[6-(trifluoromethyl)pyrimidin-4-yl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-1-piperidin-1-ylethanone |
| SMILES | O=C(C[C@@H]1OC[C@H]2CN(c3cc(C(F)(F)F)ncn3)CC[C@H]21)N1CCCCC1 |
| InChI | InChI=1S/C19H25F3N4O2/c20-19(21,22)16-9-17(24-12-23-16)26-7-4-14-13(10-26)11-28-15(14)8-18(27)25-5-2-1-3-6-25/h9,12-15H,1-8,10-11H2/t13-,14-,15+/m1/s1 |
| InChIKey | NUYFSYYLWUEYPH-KFWWJZLASA-N |
| XLogP | 2.74 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |