C18H22N2O5S — CID 131685853
4-[[(3S,3aS,6aS)-5-(3-methylsulfonylpropanoyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methoxy]benzonitrile (PubChem CID 131685853) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is 4-[[(3S,3aS,6aS)-5-(3-methylsulfonylpropanoyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methoxy]benzonitrile.
| Compound Name | 4-[[(3S,3aS,6aS)-5-(3-methylsulfonylpropanoyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 131685853 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 4-[[(3S,3aS,6aS)-5-(3-methylsulfonylpropanoyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methoxy]benzonitrile |
| SMILES | CS(=O)(=O)CCC(=O)N1C[C@@H]2[C@H](COc3ccc(C#N)cc3)CO[C@@H]2C1 |
| InChI | InChI=1S/C18H22N2O5S/c1-26(22,23)7-6-18(21)20-9-16-14(12-25-17(16)10-20)11-24-15-4-2-13(8-19)3-5-15/h2-5,14,16-17H,6-7,9-12H2,1H3/t14-,16-,17-/m1/s1 |
| InChIKey | IMVOSNYLDCGQOJ-DJIMGWMZSA-N |
| XLogP | 0.85 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |