C16H22FN3O2S — CID 131685932
[(4aR,7aS)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(1-fluorocyclobutyl)methanone (PubChem CID 131685932) has the molecular formula C16H22FN3O2S and a molecular weight of 339.44 g/mol. Its IUPAC name is [(4aR,7aS)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(1-fluorocyclobutyl)methanone.
| Compound Name | [(4aR,7aS)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(1-fluorocyclobutyl)methanone |
|---|---|
| PubChem CID | 131685932 |
| Molecular Formula | C16H22FN3O2S |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | [(4aR,7aS)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(1-fluorocyclobutyl)methanone |
| SMILES | Cc1nc(CN2CCO[C@H]3CN(C(=O)C4(F)CCC4)C[C@H]32)cs1 |
| InChI | InChI=1S/C16H22FN3O2S/c1-11-18-12(10-23-11)7-19-5-6-22-14-9-20(8-13(14)19)15(21)16(17)3-2-4-16/h10,13-14H,2-9H2,1H3/t13-,14+/m1/s1 |
| InChIKey | APNGJKYTQKVAJZ-KGLIPLIRSA-N |
| XLogP | 1.76 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |