About N-[6-(3,3-difluorocyclobutanecarbonyl)-6-azaspiro[3.4]octan-2-yl]methanesulfonamide
N-[6-(3,3-difluorocyclobutanecarbonyl)-6-azaspiro[3.4]octan-2-yl]methanesulfonamide (PubChem CID 131686067) has the molecular formula C13H20F2N2O3S
and a molecular weight of 322.38 g/mol. Its IUPAC name is N-[6-(3,3-difluorocyclobutanecarbonyl)-6-azaspiro[3.4]octan-2-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[6-(3,3-difluorocyclobutanecarbonyl)-6-azaspiro[3.4]octan-2-yl]methanesulfonamide |
| PubChem CID | 131686067 |
| Molecular Formula | C13H20F2N2O3S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N-[6-(3,3-difluorocyclobutanecarbonyl)-6-azaspiro[3.4]octan-2-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CC2(CCN(C(=O)C3CC(F)(F)C3)C2)C1 |
| InChI | InChI=1S/C13H20F2N2O3S/c1-21(19,20)16-10-6-12(7-10)2-3-17(8-12)11(18)9-4-13(14,15)5-9/h9-10,16H,2-8H2,1H3 |
| InChIKey | DOQSAIKMCJBDGA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[6-(3,3-difluorocyclobutanecarbonyl)-6-azaspiro[3.4]octan-2-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(3,3-difluorocyclobutanecarbonyl)-6-azaspiro[3.4]octan-2-yl]methanesulfonamide?
The IUPAC name of N-[6-(3,3-difluorocyclobutanecarbonyl)-6-azaspiro[3.4]octan-2-yl]methanesulfonamide (CID 131686067) is N-[6-(3,3-difluorocyclobutanecarbonyl)-6-azaspiro[3.4]octan-2-yl]methanesulfonamide.
What is the SMILES notation for N-[6-(3,3-difluorocyclobutanecarbonyl)-6-azaspiro[3.4]octan-2-yl]methanesulfonamide?
The canonical SMILES for N-[6-(3,3-difluorocyclobutanecarbonyl)-6-azaspiro[3.4]octan-2-yl]methanesulfonamide is CS(=O)(=O)NC1CC2(CCN(C(=O)C3CC(F)(F)C3)C2)C1.
What is the InChIKey of N-[6-(3,3-difluorocyclobutanecarbonyl)-6-azaspiro[3.4]octan-2-yl]methanesulfonamide?
The InChIKey is DOQSAIKMCJBDGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F2N2O3S/c1-21(19,20)16-10-6-12(7-10)2-3-17(8-12)11(18)9-4-13(14,15)5-9/h9-10,16H,2-8H2,1H3.
What are the key properties of N-[6-(3,3-difluorocyclobutanecarbonyl)-6-azaspiro[3.4]octan-2-yl]methanesulfonamide?
N-[6-(3,3-difluorocyclobutanecarbonyl)-6-azaspiro[3.4]octan-2-yl]methanesulfonamide has a molecular weight of 322.38 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(3,3-difluorocyclobutanecarbonyl)-6-azaspiro[3.4]octan-2-yl]methanesulfonamide is sourced from PubChem (CID 131686067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).