C13H18N4O4S — CID 131686387
[(3aS,6aS)-5-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(5-methoxypyrimidin-2-yl)methanone (PubChem CID 131686387) has the molecular formula C13H18N4O4S and a molecular weight of 326.38 g/mol. Its IUPAC name is [(3aS,6aS)-5-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(5-methoxypyrimidin-2-yl)methanone.
| Compound Name | [(3aS,6aS)-5-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(5-methoxypyrimidin-2-yl)methanone |
|---|---|
| PubChem CID | 131686387 |
| Molecular Formula | C13H18N4O4S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | [(3aS,6aS)-5-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(5-methoxypyrimidin-2-yl)methanone |
| SMILES | COc1cnc(C(=O)N2CC[C@H]3CN(S(C)(=O)=O)C[C@H]32)nc1 |
| InChI | InChI=1S/C13H18N4O4S/c1-21-10-5-14-12(15-6-10)13(18)17-4-3-9-7-16(8-11(9)17)22(2,19)20/h5-6,9,11H,3-4,7-8H2,1-2H3/t9-,11+/m0/s1 |
| InChIKey | FRVFBDLHAYKNQL-GXSJLCMTSA-N |
| XLogP | -0.41 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |