C14H24N2O5S — CID 131686854
1-[(4aR,7aS)-4-methylsulfonyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2-(1-methoxycyclobutyl)ethanone (PubChem CID 131686854) has the molecular formula C14H24N2O5S and a molecular weight of 332.42 g/mol. Its IUPAC name is 1-[(4aR,7aS)-4-methylsulfonyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2-(1-methoxycyclobutyl)ethanone.
| Compound Name | 1-[(4aR,7aS)-4-methylsulfonyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2-(1-methoxycyclobutyl)ethanone |
|---|---|
| PubChem CID | 131686854 |
| Molecular Formula | C14H24N2O5S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-[(4aR,7aS)-4-methylsulfonyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2-(1-methoxycyclobutyl)ethanone |
| SMILES | COC1(CC(=O)N2C[C@@H]3OCCN(S(C)(=O)=O)[C@@H]3C2)CCC1 |
| InChI | InChI=1S/C14H24N2O5S/c1-20-14(4-3-5-14)8-13(17)15-9-11-12(10-15)21-7-6-16(11)22(2,18)19/h11-12H,3-10H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | IMGRLPIXEYKNNX-NEPJUHHUSA-N |
| XLogP | -0.18 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |