About 3-[7-(3,3-difluorocyclobutanecarbonyl)-7-azaspiro[3.5]nonan-2-yl]-1,1-dimethylurea
3-[7-(3,3-difluorocyclobutanecarbonyl)-7-azaspiro[3.5]nonan-2-yl]-1,1-dimethylurea (PubChem CID 131686916) has the molecular formula C16H25F2N3O2
and a molecular weight of 329.39 g/mol. Its IUPAC name is 3-[7-(3,3-difluorocyclobutanecarbonyl)-7-azaspiro[3.5]nonan-2-yl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[7-(3,3-difluorocyclobutanecarbonyl)-7-azaspiro[3.5]nonan-2-yl]-1,1-dimethylurea |
| PubChem CID | 131686916 |
| Molecular Formula | C16H25F2N3O2 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 3-[7-(3,3-difluorocyclobutanecarbonyl)-7-azaspiro[3.5]nonan-2-yl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC1CC2(CCN(C(=O)C3CC(F)(F)C3)CC2)C1 |
| InChI | InChI=1S/C16H25F2N3O2/c1-20(2)14(23)19-12-9-15(10-12)3-5-21(6-4-15)13(22)11-7-16(17,18)8-11/h11-12H,3-10H2,1-2H3,(H,19,23) |
| InChIKey | LWOOXEJFCDLMAZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[7-(3,3-difluorocyclobutanecarbonyl)-7-azaspiro[3.5]nonan-2-yl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[7-(3,3-difluorocyclobutanecarbonyl)-7-azaspiro[3.5]nonan-2-yl]-1,1-dimethylurea?
The IUPAC name of 3-[7-(3,3-difluorocyclobutanecarbonyl)-7-azaspiro[3.5]nonan-2-yl]-1,1-dimethylurea (CID 131686916) is 3-[7-(3,3-difluorocyclobutanecarbonyl)-7-azaspiro[3.5]nonan-2-yl]-1,1-dimethylurea.
What is the SMILES notation for 3-[7-(3,3-difluorocyclobutanecarbonyl)-7-azaspiro[3.5]nonan-2-yl]-1,1-dimethylurea?
The canonical SMILES for 3-[7-(3,3-difluorocyclobutanecarbonyl)-7-azaspiro[3.5]nonan-2-yl]-1,1-dimethylurea is CN(C)C(=O)NC1CC2(CCN(C(=O)C3CC(F)(F)C3)CC2)C1.
What is the InChIKey of 3-[7-(3,3-difluorocyclobutanecarbonyl)-7-azaspiro[3.5]nonan-2-yl]-1,1-dimethylurea?
The InChIKey is LWOOXEJFCDLMAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25F2N3O2/c1-20(2)14(23)19-12-9-15(10-12)3-5-21(6-4-15)13(22)11-7-16(17,18)8-11/h11-12H,3-10H2,1-2H3,(H,19,23).
What are the key properties of 3-[7-(3,3-difluorocyclobutanecarbonyl)-7-azaspiro[3.5]nonan-2-yl]-1,1-dimethylurea?
3-[7-(3,3-difluorocyclobutanecarbonyl)-7-azaspiro[3.5]nonan-2-yl]-1,1-dimethylurea has a molecular weight of 329.39 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[7-(3,3-difluorocyclobutanecarbonyl)-7-azaspiro[3.5]nonan-2-yl]-1,1-dimethylurea is sourced from PubChem (CID 131686916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).