C16H21FN4O2 — CID 131687222
[3-[4-(cyclobutylamino)pyrimidin-2-yl]morpholin-4-yl]-(1-fluorocyclopropyl)methanone (PubChem CID 131687222) has the molecular formula C16H21FN4O2 and a molecular weight of 320.37 g/mol. Its IUPAC name is [3-[4-(cyclobutylamino)pyrimidin-2-yl]morpholin-4-yl]-(1-fluorocyclopropyl)methanone.
| Compound Name | [3-[4-(cyclobutylamino)pyrimidin-2-yl]morpholin-4-yl]-(1-fluorocyclopropyl)methanone |
|---|---|
| PubChem CID | 131687222 |
| Molecular Formula | C16H21FN4O2 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | [3-[4-(cyclobutylamino)pyrimidin-2-yl]morpholin-4-yl]-(1-fluorocyclopropyl)methanone |
| SMILES | O=C(N1CCOCC1c1nccc(NC2CCC2)n1)C1(F)CC1 |
| InChI | InChI=1S/C16H21FN4O2/c17-16(5-6-16)15(22)21-8-9-23-10-12(21)14-18-7-4-13(20-14)19-11-2-1-3-11/h4,7,11-12H,1-3,5-6,8-10H2,(H,18,19,20) |
| InChIKey | GLWCGFSLSBBJSP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |