C16H18N4O4 — CID 131687468
3-[(2S,3aS,6aS)-2-(3-methyl-1,2,4-oxadiazol-5-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-5-carbonyl]-1-methylpyridin-2-one (PubChem CID 131687468) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 3-[(2S,3aS,6aS)-2-(3-methyl-1,2,4-oxadiazol-5-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-5-carbonyl]-1-methylpyridin-2-one.
| Compound Name | 3-[(2S,3aS,6aS)-2-(3-methyl-1,2,4-oxadiazol-5-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-5-carbonyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 131687468 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 3-[(2S,3aS,6aS)-2-(3-methyl-1,2,4-oxadiazol-5-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-5-carbonyl]-1-methylpyridin-2-one |
| SMILES | Cc1noc([C@@H]2C[C@H]3CN(C(=O)c4cccn(C)c4=O)C[C@H]3O2)n1 |
| InChI | InChI=1S/C16H18N4O4/c1-9-17-14(24-18-9)12-6-10-7-20(8-13(10)23-12)16(22)11-4-3-5-19(2)15(11)21/h3-5,10,12-13H,6-8H2,1-2H3/t10-,12-,13+/m0/s1 |
| InChIKey | ZBFLJYSLYBWMQY-WCFLWFBJSA-N |
| XLogP | 0.68 |
| TPSA | 90.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |