About (5,5-dimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethylhexanoate
(5,5-dimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethylhexanoate (PubChem CID 13168775) has the molecular formula C17H30O2
and a molecular weight of 266.42 g/mol. Its IUPAC name is (5,5-dimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethylhexanoate.
Molecular Properties
| Compound Name | (5,5-dimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethylhexanoate |
| PubChem CID | 13168775 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (5,5-dimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)OC1CC2CC1CC2(C)C |
| InChI | InChI=1S/C17H30O2/c1-5-7-8-12(6-2)16(18)19-15-10-14-9-13(15)11-17(14,3)4/h12-15H,5-11H2,1-4H3 |
| InChIKey | LOXBKJSQFJQANL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5,5-dimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,5-dimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethylhexanoate?
The IUPAC name of (5,5-dimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethylhexanoate (CID 13168775) is (5,5-dimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethylhexanoate.
What is the SMILES notation for (5,5-dimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethylhexanoate?
The canonical SMILES for (5,5-dimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethylhexanoate is CCCCC(CC)C(=O)OC1CC2CC1CC2(C)C.
What is the InChIKey of (5,5-dimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethylhexanoate?
The InChIKey is LOXBKJSQFJQANL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O2/c1-5-7-8-12(6-2)16(18)19-15-10-14-9-13(15)11-17(14,3)4/h12-15H,5-11H2,1-4H3.
What are the key properties of (5,5-dimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethylhexanoate?
(5,5-dimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethylhexanoate has a molecular weight of 266.42 g/mol, XLogP of 4.57, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5,5-dimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethylhexanoate is sourced from PubChem (CID 13168775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).