C13H17N3O3 — CID 131688070
[(2S,3aR,6aR)-2-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(5-methoxypyrimidin-2-yl)methanone (PubChem CID 131688070) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is [(2S,3aR,6aR)-2-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(5-methoxypyrimidin-2-yl)methanone.
| Compound Name | [(2S,3aR,6aR)-2-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(5-methoxypyrimidin-2-yl)methanone |
|---|---|
| PubChem CID | 131688070 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | [(2S,3aR,6aR)-2-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(5-methoxypyrimidin-2-yl)methanone |
| SMILES | COc1cnc(C(=O)N2C[C@H]3C[C@H](C)O[C@H]3C2)nc1 |
| InChI | InChI=1S/C13H17N3O3/c1-8-3-9-6-16(7-11(9)19-8)13(17)12-14-4-10(18-2)5-15-12/h4-5,8-9,11H,3,6-7H2,1-2H3/t8-,9+,11-/m0/s1 |
| InChIKey | AWMNZQFXIBOHBB-NGZCFLSTSA-N |
| XLogP | 0.73 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |