C16H25N3O2 — CID 131688143
1-(4-propan-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonyl)cyclopentane-1-carbonitrile (PubChem CID 131688143) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 1-(4-propan-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonyl)cyclopentane-1-carbonitrile.
| Compound Name | 1-(4-propan-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonyl)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 131688143 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 1-(4-propan-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonyl)cyclopentane-1-carbonitrile |
| SMILES | CC(C)N1CCOC2CN(C(=O)C3(C#N)CCCC3)CC21 |
| InChI | InChI=1S/C16H25N3O2/c1-12(2)19-7-8-21-14-10-18(9-13(14)19)15(20)16(11-17)5-3-4-6-16/h12-14H,3-10H2,1-2H3 |
| InChIKey | RVJUDWHFPLDCLU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |