About (5-chloro-1-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1'-yl)-(thiadiazol-4-yl)methanone
(5-chloro-1-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1'-yl)-(thiadiazol-4-yl)methanone (PubChem CID 131688181) has the molecular formula C18H19ClN4OS
and a molecular weight of 374.90 g/mol. Its IUPAC name is (5-chloro-1-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1'-yl)-(thiadiazol-4-yl)methanone.
Molecular Properties
| Compound Name | (5-chloro-1-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1'-yl)-(thiadiazol-4-yl)methanone |
| PubChem CID | 131688181 |
| Molecular Formula | C18H19ClN4OS |
| Molecular Weight | 374.90 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (5-chloro-1-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1'-yl)-(thiadiazol-4-yl)methanone |
| SMILES | C=CCN1CC2(CCN(C(=O)c3csnn3)CC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H19ClN4OS/c1-2-7-23-12-18(14-10-13(19)3-4-16(14)23)5-8-22(9-6-18)17(24)15-11-25-21-20-15/h2-4,10-11H,1,5-9,12H2 |
| InChIKey | URJIKCBNXUNBTM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.90 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-1-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1'-yl)-(thiadiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-1-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1'-yl)-(thiadiazol-4-yl)methanone?
The IUPAC name of (5-chloro-1-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1'-yl)-(thiadiazol-4-yl)methanone (CID 131688181) is (5-chloro-1-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1'-yl)-(thiadiazol-4-yl)methanone.
What is the SMILES notation for (5-chloro-1-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1'-yl)-(thiadiazol-4-yl)methanone?
The canonical SMILES for (5-chloro-1-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1'-yl)-(thiadiazol-4-yl)methanone is C=CCN1CC2(CCN(C(=O)c3csnn3)CC2)c2cc(Cl)ccc21.
What is the InChIKey of (5-chloro-1-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1'-yl)-(thiadiazol-4-yl)methanone?
The InChIKey is URJIKCBNXUNBTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN4OS/c1-2-7-23-12-18(14-10-13(19)3-4-16(14)23)5-8-22(9-6-18)17(24)15-11-25-21-20-15/h2-4,10-11H,1,5-9,12H2.
What are the key properties of (5-chloro-1-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1'-yl)-(thiadiazol-4-yl)methanone?
(5-chloro-1-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1'-yl)-(thiadiazol-4-yl)methanone has a molecular weight of 374.90 g/mol, XLogP of 3.37, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-1-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1'-yl)-(thiadiazol-4-yl)methanone is sourced from PubChem (CID 131688181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).