C17H22N4O3 — CID 131688328
(5S,9S)-7-(5-methoxypyrimidine-2-carbonyl)-9-methyl-2-prop-2-enyl-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 131688328) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is (5S,9S)-7-(5-methoxypyrimidine-2-carbonyl)-9-methyl-2-prop-2-enyl-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | (5S,9S)-7-(5-methoxypyrimidine-2-carbonyl)-9-methyl-2-prop-2-enyl-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 131688328 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (5S,9S)-7-(5-methoxypyrimidine-2-carbonyl)-9-methyl-2-prop-2-enyl-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | C=CCN1CC[C@]2(CN(C(=O)c3ncc(OC)cn3)C[C@H]2C)C1=O |
| InChI | InChI=1S/C17H22N4O3/c1-4-6-20-7-5-17(16(20)23)11-21(10-12(17)2)15(22)14-18-8-13(24-3)9-19-14/h4,8-9,12H,1,5-7,10-11H2,2-3H3/t12-,17-/m1/s1 |
| InChIKey | LVWKJRYTALFOIK-SJKOYZFVSA-N |
| XLogP | 0.98 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|