C10H16FNO2 — CID 131688542
1-[(2S,3aR,6aR)-2-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-3-fluoropropan-1-one (PubChem CID 131688542) has the molecular formula C10H16FNO2 and a molecular weight of 201.24 g/mol. Its IUPAC name is 1-[(2S,3aR,6aR)-2-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-3-fluoropropan-1-one.
| Compound Name | 1-[(2S,3aR,6aR)-2-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-3-fluoropropan-1-one |
|---|---|
| PubChem CID | 131688542 |
| Molecular Formula | C10H16FNO2 |
| Molecular Weight | 201.24 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1-[(2S,3aR,6aR)-2-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-3-fluoropropan-1-one |
| SMILES | C[C@H]1C[C@@H]2CN(C(=O)CCF)C[C@@H]2O1 |
| InChI | InChI=1S/C10H16FNO2/c1-7-4-8-5-12(6-9(8)14-7)10(13)2-3-11/h7-9H,2-6H2,1H3/t7-,8+,9-/m0/s1 |
| InChIKey | FEWSSCAEFAGWKX-YIZRAAEISA-N |
| XLogP | 0.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |