C19H20N2O2S — CID 131688555
8-benzoyl-2-thiophen-3-yl-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 131688555) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 8-benzoyl-2-thiophen-3-yl-2,8-diazaspiro[4.5]decan-1-one.
| Compound Name | 8-benzoyl-2-thiophen-3-yl-2,8-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 131688555 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 8-benzoyl-2-thiophen-3-yl-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | O=C(c1ccccc1)N1CCC2(CC1)CCN(c1ccsc1)C2=O |
| InChI | InChI=1S/C19H20N2O2S/c22-17(15-4-2-1-3-5-15)20-10-7-19(8-11-20)9-12-21(18(19)23)16-6-13-24-14-16/h1-6,13-14H,7-12H2 |
| InChIKey | IWTJHTRLRPKQQS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |