About 3-(8,8-difluoro-3-azabicyclo[3.2.1]octane-3-carbonyl)-1-methylpyridin-2-one
3-(8,8-difluoro-3-azabicyclo[3.2.1]octane-3-carbonyl)-1-methylpyridin-2-one (PubChem CID 131688710) has the molecular formula C14H16F2N2O2
and a molecular weight of 282.29 g/mol. Its IUPAC name is 3-(8,8-difluoro-3-azabicyclo[3.2.1]octane-3-carbonyl)-1-methylpyridin-2-one.
Molecular Properties
| Compound Name | 3-(8,8-difluoro-3-azabicyclo[3.2.1]octane-3-carbonyl)-1-methylpyridin-2-one |
| PubChem CID | 131688710 |
| Molecular Formula | C14H16F2N2O2 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-(8,8-difluoro-3-azabicyclo[3.2.1]octane-3-carbonyl)-1-methylpyridin-2-one |
| SMILES | Cn1cccc(C(=O)N2CC3CCC(C2)C3(F)F)c1=O |
| InChI | InChI=1S/C14H16F2N2O2/c1-17-6-2-3-11(12(17)19)13(20)18-7-9-4-5-10(8-18)14(9,15)16/h2-3,6,9-10H,4-5,7-8H2,1H3 |
| InChIKey | WFJUFBPKFIALHF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(8,8-difluoro-3-azabicyclo[3.2.1]octane-3-carbonyl)-1-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8,8-difluoro-3-azabicyclo[3.2.1]octane-3-carbonyl)-1-methylpyridin-2-one?
The IUPAC name of 3-(8,8-difluoro-3-azabicyclo[3.2.1]octane-3-carbonyl)-1-methylpyridin-2-one (CID 131688710) is 3-(8,8-difluoro-3-azabicyclo[3.2.1]octane-3-carbonyl)-1-methylpyridin-2-one.
What is the SMILES notation for 3-(8,8-difluoro-3-azabicyclo[3.2.1]octane-3-carbonyl)-1-methylpyridin-2-one?
The canonical SMILES for 3-(8,8-difluoro-3-azabicyclo[3.2.1]octane-3-carbonyl)-1-methylpyridin-2-one is Cn1cccc(C(=O)N2CC3CCC(C2)C3(F)F)c1=O.
What is the InChIKey of 3-(8,8-difluoro-3-azabicyclo[3.2.1]octane-3-carbonyl)-1-methylpyridin-2-one?
The InChIKey is WFJUFBPKFIALHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F2N2O2/c1-17-6-2-3-11(12(17)19)13(20)18-7-9-4-5-10(8-18)14(9,15)16/h2-3,6,9-10H,4-5,7-8H2,1H3.
What are the key properties of 3-(8,8-difluoro-3-azabicyclo[3.2.1]octane-3-carbonyl)-1-methylpyridin-2-one?
3-(8,8-difluoro-3-azabicyclo[3.2.1]octane-3-carbonyl)-1-methylpyridin-2-one has a molecular weight of 282.29 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8,8-difluoro-3-azabicyclo[3.2.1]octane-3-carbonyl)-1-methylpyridin-2-one is sourced from PubChem (CID 131688710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).