C14H19ClN4O4S — CID 131689146
N-[[(3S,3aR,7aR)-5-(5-chloropyrimidine-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]methanesulfonamide (PubChem CID 131689146) has the molecular formula C14H19ClN4O4S and a molecular weight of 374.85 g/mol. Its IUPAC name is N-[[(3S,3aR,7aR)-5-(5-chloropyrimidine-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(3S,3aR,7aR)-5-(5-chloropyrimidine-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 131689146 |
| Molecular Formula | C14H19ClN4O4S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | N-[[(3S,3aR,7aR)-5-(5-chloropyrimidine-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@H]1OC[C@@H]2CCN(C(=O)c3ncc(Cl)cn3)C[C@@H]21 |
| InChI | InChI=1S/C14H19ClN4O4S/c1-24(21,22)18-6-12-11-7-19(3-2-9(11)8-23-12)14(20)13-16-4-10(15)5-17-13/h4-5,9,11-12,18H,2-3,6-8H2,1H3/t9-,11-,12+/m0/s1 |
| InChIKey | JPQMXHDZJWAHRE-ZMLRMANQSA-N |
| XLogP | 0.16 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |