C18H24F2N4O3 — CID 131689200
N-cyclopentyl-5-[[(3,3-difluorocyclobutanecarbonyl)amino]methyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 131689200) has the molecular formula C18H24F2N4O3 and a molecular weight of 382.41 g/mol. Its IUPAC name is N-cyclopentyl-5-[[(3,3-difluorocyclobutanecarbonyl)amino]methyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | N-cyclopentyl-5-[[(3,3-difluorocyclobutanecarbonyl)amino]methyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 131689200 |
| Molecular Formula | C18H24F2N4O3 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-cyclopentyl-5-[[(3,3-difluorocyclobutanecarbonyl)amino]methyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | O=C(NC1CCCC1)c1n[nH]c2c1CC(CNC(=O)C1CC(F)(F)C1)OC2 |
| InChI | InChI=1S/C18H24F2N4O3/c19-18(20)6-10(7-18)16(25)21-8-12-5-13-14(9-27-12)23-24-15(13)17(26)22-11-3-1-2-4-11/h10-12H,1-9H2,(H,21,25)(H,22,26)(H,23,24) |
| InChIKey | ZPAZULYFVYTHAZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |