About (3-fluorocyclobutyl)-[2-(1,3-thiazole-4-carbonyl)-2,9-diazaspiro[5.5]undecan-9-yl]methanone
(3-fluorocyclobutyl)-[2-(1,3-thiazole-4-carbonyl)-2,9-diazaspiro[5.5]undecan-9-yl]methanone (PubChem CID 131689425) has the molecular formula C18H24FN3O2S
and a molecular weight of 365.47 g/mol. Its IUPAC name is (3-fluorocyclobutyl)-[2-(1,3-thiazole-4-carbonyl)-2,9-diazaspiro[5.5]undecan-9-yl]methanone.
Molecular Properties
| Compound Name | (3-fluorocyclobutyl)-[2-(1,3-thiazole-4-carbonyl)-2,9-diazaspiro[5.5]undecan-9-yl]methanone |
| PubChem CID | 131689425 |
| Molecular Formula | C18H24FN3O2S |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (3-fluorocyclobutyl)-[2-(1,3-thiazole-4-carbonyl)-2,9-diazaspiro[5.5]undecan-9-yl]methanone |
| SMILES | O=C(c1cscn1)N1CCCC2(CCN(C(=O)C3CC(F)C3)CC2)C1 |
| InChI | InChI=1S/C18H24FN3O2S/c19-14-8-13(9-14)16(23)21-6-3-18(4-7-21)2-1-5-22(11-18)17(24)15-10-25-12-20-15/h10,12-14H,1-9,11H2 |
| InChIKey | RVBUSRDYFHNHGK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-fluorocyclobutyl)-[2-(1,3-thiazole-4-carbonyl)-2,9-diazaspiro[5.5]undecan-9-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluorocyclobutyl)-[2-(1,3-thiazole-4-carbonyl)-2,9-diazaspiro[5.5]undecan-9-yl]methanone?
The IUPAC name of (3-fluorocyclobutyl)-[2-(1,3-thiazole-4-carbonyl)-2,9-diazaspiro[5.5]undecan-9-yl]methanone (CID 131689425) is (3-fluorocyclobutyl)-[2-(1,3-thiazole-4-carbonyl)-2,9-diazaspiro[5.5]undecan-9-yl]methanone.
What is the SMILES notation for (3-fluorocyclobutyl)-[2-(1,3-thiazole-4-carbonyl)-2,9-diazaspiro[5.5]undecan-9-yl]methanone?
The canonical SMILES for (3-fluorocyclobutyl)-[2-(1,3-thiazole-4-carbonyl)-2,9-diazaspiro[5.5]undecan-9-yl]methanone is O=C(c1cscn1)N1CCCC2(CCN(C(=O)C3CC(F)C3)CC2)C1.
What is the InChIKey of (3-fluorocyclobutyl)-[2-(1,3-thiazole-4-carbonyl)-2,9-diazaspiro[5.5]undecan-9-yl]methanone?
The InChIKey is RVBUSRDYFHNHGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24FN3O2S/c19-14-8-13(9-14)16(23)21-6-3-18(4-7-21)2-1-5-22(11-18)17(24)15-10-25-12-20-15/h10,12-14H,1-9,11H2.
What are the key properties of (3-fluorocyclobutyl)-[2-(1,3-thiazole-4-carbonyl)-2,9-diazaspiro[5.5]undecan-9-yl]methanone?
(3-fluorocyclobutyl)-[2-(1,3-thiazole-4-carbonyl)-2,9-diazaspiro[5.5]undecan-9-yl]methanone has a molecular weight of 365.47 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorocyclobutyl)-[2-(1,3-thiazole-4-carbonyl)-2,9-diazaspiro[5.5]undecan-9-yl]methanone is sourced from PubChem (CID 131689425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).