C17H27N5O3 — CID 131689530
(1-methyl-1,2,4-triazol-3-yl)-[4-(oxan-4-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]methanone (PubChem CID 131689530) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is (1-methyl-1,2,4-triazol-3-yl)-[4-(oxan-4-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]methanone.
| Compound Name | (1-methyl-1,2,4-triazol-3-yl)-[4-(oxan-4-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]methanone |
|---|---|
| PubChem CID | 131689530 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | (1-methyl-1,2,4-triazol-3-yl)-[4-(oxan-4-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]methanone |
| SMILES | Cn1cnc(C(=O)N2CCC3CN(C4CCOCC4)CCOC3C2)n1 |
| InChI | InChI=1S/C17H27N5O3/c1-20-12-18-16(19-20)17(23)22-5-2-13-10-21(6-9-25-15(13)11-22)14-3-7-24-8-4-14/h12-15H,2-11H2,1H3 |
| InChIKey | ARHXTIXCHZVADO-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |