About 6'-methyl-1-(3-methylsulfonylpropanoyl)spiro[piperidine-4,7'-pyrrolo[3,4-b]pyridine]-5'-one
6'-methyl-1-(3-methylsulfonylpropanoyl)spiro[piperidine-4,7'-pyrrolo[3,4-b]pyridine]-5'-one (PubChem CID 131690243) has the molecular formula C16H21N3O4S
and a molecular weight of 351.43 g/mol. Its IUPAC name is 6'-methyl-1-(3-methylsulfonylpropanoyl)spiro[piperidine-4,7'-pyrrolo[3,4-b]pyridine]-5'-one.
Molecular Properties
| Compound Name | 6'-methyl-1-(3-methylsulfonylpropanoyl)spiro[piperidine-4,7'-pyrrolo[3,4-b]pyridine]-5'-one |
| PubChem CID | 131690243 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 6'-methyl-1-(3-methylsulfonylpropanoyl)spiro[piperidine-4,7'-pyrrolo[3,4-b]pyridine]-5'-one |
| SMILES | CN1C(=O)c2cccnc2C12CCN(C(=O)CCS(C)(=O)=O)CC2 |
| InChI | InChI=1S/C16H21N3O4S/c1-18-15(21)12-4-3-8-17-14(12)16(18)6-9-19(10-7-16)13(20)5-11-24(2,22)23/h3-4,8H,5-7,9-11H2,1-2H3 |
| InChIKey | GLIADWDFPDTWHK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6'-methyl-1-(3-methylsulfonylpropanoyl)spiro[piperidine-4,7'-pyrrolo[3,4-b]pyridine]-5'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6'-methyl-1-(3-methylsulfonylpropanoyl)spiro[piperidine-4,7'-pyrrolo[3,4-b]pyridine]-5'-one?
The IUPAC name of 6'-methyl-1-(3-methylsulfonylpropanoyl)spiro[piperidine-4,7'-pyrrolo[3,4-b]pyridine]-5'-one (CID 131690243) is 6'-methyl-1-(3-methylsulfonylpropanoyl)spiro[piperidine-4,7'-pyrrolo[3,4-b]pyridine]-5'-one.
What is the SMILES notation for 6'-methyl-1-(3-methylsulfonylpropanoyl)spiro[piperidine-4,7'-pyrrolo[3,4-b]pyridine]-5'-one?
The canonical SMILES for 6'-methyl-1-(3-methylsulfonylpropanoyl)spiro[piperidine-4,7'-pyrrolo[3,4-b]pyridine]-5'-one is CN1C(=O)c2cccnc2C12CCN(C(=O)CCS(C)(=O)=O)CC2.
What is the InChIKey of 6'-methyl-1-(3-methylsulfonylpropanoyl)spiro[piperidine-4,7'-pyrrolo[3,4-b]pyridine]-5'-one?
The InChIKey is GLIADWDFPDTWHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O4S/c1-18-15(21)12-4-3-8-17-14(12)16(18)6-9-19(10-7-16)13(20)5-11-24(2,22)23/h3-4,8H,5-7,9-11H2,1-2H3.
What are the key properties of 6'-methyl-1-(3-methylsulfonylpropanoyl)spiro[piperidine-4,7'-pyrrolo[3,4-b]pyridine]-5'-one?
6'-methyl-1-(3-methylsulfonylpropanoyl)spiro[piperidine-4,7'-pyrrolo[3,4-b]pyridine]-5'-one has a molecular weight of 351.43 g/mol, XLogP of 0.42, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6'-methyl-1-(3-methylsulfonylpropanoyl)spiro[piperidine-4,7'-pyrrolo[3,4-b]pyridine]-5'-one is sourced from PubChem (CID 131690243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).