C18H23F2N3O3 — CID 131690837
9-(2,5-difluoropyridine-4-carbonyl)-2-(2-methoxyethyl)-2,9-diazaspiro[5.5]undecan-1-one (PubChem CID 131690837) has the molecular formula C18H23F2N3O3 and a molecular weight of 367.40 g/mol. Its IUPAC name is 9-(2,5-difluoropyridine-4-carbonyl)-2-(2-methoxyethyl)-2,9-diazaspiro[5.5]undecan-1-one.
| Compound Name | 9-(2,5-difluoropyridine-4-carbonyl)-2-(2-methoxyethyl)-2,9-diazaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 131690837 |
| Molecular Formula | C18H23F2N3O3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 9-(2,5-difluoropyridine-4-carbonyl)-2-(2-methoxyethyl)-2,9-diazaspiro[5.5]undecan-1-one |
| SMILES | COCCN1CCCC2(CCN(C(=O)c3cc(F)ncc3F)CC2)C1=O |
| InChI | InChI=1S/C18H23F2N3O3/c1-26-10-9-23-6-2-3-18(17(23)25)4-7-22(8-5-18)16(24)13-11-15(20)21-12-14(13)19/h11-12H,2-10H2,1H3 |
| InChIKey | LCPQQVXGTHTGNQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|