C12H13F2N3O3S — CID 131690895
(2,5-difluoro-4-pyridinyl)-[(1R,5R)-3-methylsulfonyl-3,6-diazabicyclo[3.2.0]heptan-6-yl]methanone (PubChem CID 131690895) has the molecular formula C12H13F2N3O3S and a molecular weight of 317.32 g/mol. Its IUPAC name is (2,5-difluoro-4-pyridinyl)-[(1R,5R)-3-methylsulfonyl-3,6-diazabicyclo[3.2.0]heptan-6-yl]methanone.
| Compound Name | (2,5-difluoro-4-pyridinyl)-[(1R,5R)-3-methylsulfonyl-3,6-diazabicyclo[3.2.0]heptan-6-yl]methanone |
|---|---|
| PubChem CID | 131690895 |
| Molecular Formula | C12H13F2N3O3S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (2,5-difluoro-4-pyridinyl)-[(1R,5R)-3-methylsulfonyl-3,6-diazabicyclo[3.2.0]heptan-6-yl]methanone |
| SMILES | CS(=O)(=O)N1C[C@H]2CN(C(=O)c3cc(F)ncc3F)[C@H]2C1 |
| InChI | InChI=1S/C12H13F2N3O3S/c1-21(19,20)16-4-7-5-17(10(7)6-16)12(18)8-2-11(14)15-3-9(8)13/h2-3,7,10H,4-6H2,1H3/t7-,10-/m0/s1 |
| InChIKey | WXDMGHOFFIZIGY-XVKPBYJWSA-N |
| XLogP | 0.08 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|