About 4-bromo-N,N-dibutylaniline
4-bromo-N,N-dibutylaniline (PubChem CID 13169152) has the molecular formula C14H22BrN
and a molecular weight of 284.24 g/mol. Its IUPAC name is 4-bromo-N,N-dibutylaniline.
Molecular Properties
| Compound Name | 4-bromo-N,N-dibutylaniline |
| PubChem CID | 13169152 |
| Molecular Formula | C14H22BrN |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 4-bromo-N,N-dibutylaniline |
| SMILES | CCCCN(CCCC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H22BrN/c1-3-5-11-16(12-6-4-2)14-9-7-13(15)8-10-14/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | UUZAXCYJSHWGLA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-N,N-dibutylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N,N-dibutylaniline?
The IUPAC name of 4-bromo-N,N-dibutylaniline (CID 13169152) is 4-bromo-N,N-dibutylaniline.
What is the SMILES notation for 4-bromo-N,N-dibutylaniline?
The canonical SMILES for 4-bromo-N,N-dibutylaniline is CCCCN(CCCC)c1ccc(Br)cc1.
What is the InChIKey of 4-bromo-N,N-dibutylaniline?
The InChIKey is UUZAXCYJSHWGLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22BrN/c1-3-5-11-16(12-6-4-2)14-9-7-13(15)8-10-14/h7-10H,3-6,11-12H2,1-2H3.
What are the key properties of 4-bromo-N,N-dibutylaniline?
4-bromo-N,N-dibutylaniline has a molecular weight of 284.24 g/mol, XLogP of 4.86, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N,N-dibutylaniline is sourced from PubChem (CID 13169152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).