C27H31N3O2 — CID 131691818
N-[7-(1-methylindole-2-carbonyl)-7-azaspiro[3.5]nonan-3-yl]-3-phenylpropanamide (PubChem CID 131691818) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is N-[7-(1-methylindole-2-carbonyl)-7-azaspiro[3.5]nonan-3-yl]-3-phenylpropanamide.
| Compound Name | N-[7-(1-methylindole-2-carbonyl)-7-azaspiro[3.5]nonan-3-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 131691818 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | N-[7-(1-methylindole-2-carbonyl)-7-azaspiro[3.5]nonan-3-yl]-3-phenylpropanamide |
| SMILES | Cn1c(C(=O)N2CCC3(CCC3NC(=O)CCc3ccccc3)CC2)cc2ccccc21 |
| InChI | InChI=1S/C27H31N3O2/c1-29-22-10-6-5-9-21(22)19-23(29)26(32)30-17-15-27(16-18-30)14-13-24(27)28-25(31)12-11-20-7-3-2-4-8-20/h2-10,19,24H,11-18H2,1H3,(H,28,31) |
| InChIKey | VIYSRFPJTXCLIO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |