C22H23N3O2S — CID 131692170
(1-methylindol-5-yl)-[7-(pyridin-3-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]methanone (PubChem CID 131692170) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is (1-methylindol-5-yl)-[7-(pyridin-3-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]methanone.
| Compound Name | (1-methylindol-5-yl)-[7-(pyridin-3-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]methanone |
|---|---|
| PubChem CID | 131692170 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (1-methylindol-5-yl)-[7-(pyridin-3-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]methanone |
| SMILES | Cn1ccc2cc(C(=O)N3CC4(CC(OCc5cccnc5)CS4)C3)ccc21 |
| InChI | InChI=1S/C22H23N3O2S/c1-24-8-6-17-9-18(4-5-20(17)24)21(26)25-14-22(15-25)10-19(13-28-22)27-12-16-3-2-7-23-11-16/h2-9,11,19H,10,12-15H2,1H3 |
| InChIKey | NNDRQWMGOGNAGS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |