About 1-butyl-5,6-dimethylpyridin-2-one
1-butyl-5,6-dimethylpyridin-2-one (PubChem CID 13169262) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-butyl-5,6-dimethylpyridin-2-one.
Molecular Properties
| Compound Name | 1-butyl-5,6-dimethylpyridin-2-one |
| PubChem CID | 13169262 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1-butyl-5,6-dimethylpyridin-2-one |
| SMILES | CCCCn1c(C)c(C)ccc1=O |
| InChI | InChI=1S/C11H17NO/c1-4-5-8-12-10(3)9(2)6-7-11(12)13/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | IBJXKUHLOPTGRY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butyl-5,6-dimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-5,6-dimethylpyridin-2-one?
The IUPAC name of 1-butyl-5,6-dimethylpyridin-2-one (CID 13169262) is 1-butyl-5,6-dimethylpyridin-2-one.
What is the SMILES notation for 1-butyl-5,6-dimethylpyridin-2-one?
The canonical SMILES for 1-butyl-5,6-dimethylpyridin-2-one is CCCCn1c(C)c(C)ccc1=O.
What is the InChIKey of 1-butyl-5,6-dimethylpyridin-2-one?
The InChIKey is IBJXKUHLOPTGRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-4-5-8-12-10(3)9(2)6-7-11(12)13/h6-7H,4-5,8H2,1-3H3.
What are the key properties of 1-butyl-5,6-dimethylpyridin-2-one?
1-butyl-5,6-dimethylpyridin-2-one has a molecular weight of 179.26 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-5,6-dimethylpyridin-2-one is sourced from PubChem (CID 13169262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).