C19H26N2O4 — CID 131693487
1-[[2-(3-methylfuran-2-carbonyl)-5-oxa-2-azaspiro[3.5]nonan-7-yl]methyl]piperidin-2-one (PubChem CID 131693487) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[[2-(3-methylfuran-2-carbonyl)-5-oxa-2-azaspiro[3.5]nonan-7-yl]methyl]piperidin-2-one.
| Compound Name | 1-[[2-(3-methylfuran-2-carbonyl)-5-oxa-2-azaspiro[3.5]nonan-7-yl]methyl]piperidin-2-one |
|---|---|
| PubChem CID | 131693487 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-[[2-(3-methylfuran-2-carbonyl)-5-oxa-2-azaspiro[3.5]nonan-7-yl]methyl]piperidin-2-one |
| SMILES | Cc1ccoc1C(=O)N1CC2(CCC(CN3CCCCC3=O)CO2)C1 |
| InChI | InChI=1S/C19H26N2O4/c1-14-6-9-24-17(14)18(23)21-12-19(13-21)7-5-15(11-25-19)10-20-8-3-2-4-16(20)22/h6,9,15H,2-5,7-8,10-13H2,1H3 |
| InChIKey | PXYYWRSWAFMSLI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |