C8H5N3S — CID 13169383
7-thia-3,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene (PubChem CID 13169383) has the molecular formula C8H5N3S and a molecular weight of 175.22 g/mol. Its IUPAC name is 7-thia-3,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene.
| Compound Name | 7-thia-3,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene |
|---|---|
| PubChem CID | 13169383 |
| Molecular Formula | C8H5N3S |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | 7-thia-3,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene |
| SMILES | c1cnc2sc3nc[nH]c3c2c1 |
| InChI | InChI=1S/C8H5N3S/c1-2-5-6-8(11-4-10-6)12-7(5)9-3-1/h1-4H,(H,10,11) |
| InChIKey | OXWZHKCWYGENPO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |