C16H22F2N2O2 — CID 131695182
9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 131695182) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is 9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one.
| Compound Name | 9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 131695182 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | O=C(CC1=CCCCC1)N1CC(F)(F)CC2(CCNC2=O)C1 |
| InChI | InChI=1S/C16H22F2N2O2/c17-16(18)9-15(6-7-19-14(15)22)10-20(11-16)13(21)8-12-4-2-1-3-5-12/h4H,1-3,5-11H2,(H,19,22) |
| InChIKey | CPYSWQLLCOWQEH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|