About 9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one
9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 131695182) has the molecular formula C16H22F2N2O2
and a molecular weight of 312.36 g/mol. Its IUPAC name is 9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one.
Molecular Properties
| Compound Name | 9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one |
| PubChem CID | 131695182 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | O=C(CC1=CCCCC1)N1CC(F)(F)CC2(CCNC2=O)C1 |
| InChI | InChI=1S/C16H22F2N2O2/c17-16(18)9-15(6-7-19-14(15)22)10-20(11-16)13(21)8-12-4-2-1-3-5-12/h4H,1-3,5-11H2,(H,19,22) |
| InChIKey | CPYSWQLLCOWQEH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one?
The IUPAC name of 9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one (CID 131695182) is 9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one.
What is the SMILES notation for 9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one?
The canonical SMILES for 9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one is O=C(CC1=CCCCC1)N1CC(F)(F)CC2(CCNC2=O)C1.
What is the InChIKey of 9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one?
The InChIKey is CPYSWQLLCOWQEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F2N2O2/c17-16(18)9-15(6-7-19-14(15)22)10-20(11-16)13(21)8-12-4-2-1-3-5-12/h4H,1-3,5-11H2,(H,19,22).
What are the key properties of 9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one?
9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one has a molecular weight of 312.36 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[2-(cyclohexen-1-yl)acetyl]-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one is sourced from PubChem (CID 131695182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).