C24H28N2O4 — CID 131695281
[(3R,3aR,6aR)-3-[2-[(6-methyl-2-pyridinyl)methoxy]ethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2,3-dihydro-1-benzofuran-2-yl)methanone (PubChem CID 131695281) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is [(3R,3aR,6aR)-3-[2-[(6-methyl-2-pyridinyl)methoxy]ethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2,3-dihydro-1-benzofuran-2-yl)methanone.
| Compound Name | [(3R,3aR,6aR)-3-[2-[(6-methyl-2-pyridinyl)methoxy]ethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2,3-dihydro-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 131695281 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [(3R,3aR,6aR)-3-[2-[(6-methyl-2-pyridinyl)methoxy]ethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2,3-dihydro-1-benzofuran-2-yl)methanone |
| SMILES | Cc1cccc(COCC[C@H]2CO[C@H]3CN(C(=O)C4Cc5ccccc5O4)C[C@@H]23)n1 |
| InChI | InChI=1S/C24H28N2O4/c1-16-5-4-7-19(25-16)15-28-10-9-18-14-29-23-13-26(12-20(18)23)24(27)22-11-17-6-2-3-8-21(17)30-22/h2-8,18,20,22-23H,9-15H2,1H3/t18-,20-,22?,23-/m0/s1 |
| InChIKey | YHGPPHUTJPWYSM-NHQFQXGVSA-N |
| XLogP | 2.77 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|