C17H26N4O — CID 131695771
2-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(2-methoxyethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 131695771) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(2-methoxyethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | 2-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(2-methoxyethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 131695771 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 2-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(2-methoxyethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | COCCC1CN(Cc2cc(C)nn2C)Cc2cccn2C1 |
| InChI | InChI=1S/C17H26N4O/c1-14-9-17(19(2)18-14)13-20-10-15(6-8-22-3)11-21-7-4-5-16(21)12-20/h4-5,7,9,15H,6,8,10-13H2,1-3H3 |
| InChIKey | BQARQDPXRJOYGN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |