C19H27N3O2 — CID 131695911
3-[[4-[2-(cyclopropylmethoxy)ethyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]-5-methyl-1,2-oxazole (PubChem CID 131695911) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 3-[[4-[2-(cyclopropylmethoxy)ethyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]-5-methyl-1,2-oxazole.
| Compound Name | 3-[[4-[2-(cyclopropylmethoxy)ethyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 131695911 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 3-[[4-[2-(cyclopropylmethoxy)ethyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]-5-methyl-1,2-oxazole |
| SMILES | Cc1cc(CN2Cc3cccn3CC(CCOCC3CC3)C2)no1 |
| InChI | InChI=1S/C19H27N3O2/c1-15-9-18(20-24-15)12-21-10-17(6-8-23-14-16-4-5-16)11-22-7-2-3-19(22)13-21/h2-3,7,9,16-17H,4-6,8,10-14H2,1H3 |
| InChIKey | JEKLHEVCCWSZCG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|