C16H25F2N5O — CID 131696096
1-[6-[(3,3-difluoropyrrolidin-1-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-2-(dimethylamino)ethanone (PubChem CID 131696096) has the molecular formula C16H25F2N5O and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[6-[(3,3-difluoropyrrolidin-1-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-2-(dimethylamino)ethanone.
| Compound Name | 1-[6-[(3,3-difluoropyrrolidin-1-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-2-(dimethylamino)ethanone |
|---|---|
| PubChem CID | 131696096 |
| Molecular Formula | C16H25F2N5O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 1-[6-[(3,3-difluoropyrrolidin-1-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-2-(dimethylamino)ethanone |
| SMILES | CN(C)CC(=O)N1Cc2ccnn2CCC1CN1CCC(F)(F)C1 |
| InChI | InChI=1S/C16H25F2N5O/c1-20(2)11-15(24)22-10-14-3-6-19-23(14)7-4-13(22)9-21-8-5-16(17,18)12-21/h3,6,13H,4-5,7-12H2,1-2H3 |
| InChIKey | ZTXKCKIDLGLIME-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |