C18H24FN5O2 — CID 131696103
2-[2-[2-(5-fluoropyrimidin-2-yl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]ethoxy]-N,N-dimethylacetamide (PubChem CID 131696103) has the molecular formula C18H24FN5O2 and a molecular weight of 361.42 g/mol. Its IUPAC name is 2-[2-[2-(5-fluoropyrimidin-2-yl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]ethoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[2-[2-(5-fluoropyrimidin-2-yl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]ethoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 131696103 |
| Molecular Formula | C18H24FN5O2 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 2-[2-[2-(5-fluoropyrimidin-2-yl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]ethoxy]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)COCCC1CN(c2ncc(F)cn2)Cc2cccn2C1 |
| InChI | InChI=1S/C18H24FN5O2/c1-22(2)17(25)13-26-7-5-14-10-23-6-3-4-16(23)12-24(11-14)18-20-8-15(19)9-21-18/h3-4,6,8-9,14H,5,7,10-13H2,1-2H3 |
| InChIKey | IKMQQYNOHOSWQE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|