C16H21N5O5 — CID 131697406
3-methoxy-N-[3-(2-methoxyethylcarbamoyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-1,2-oxazole-5-carboxamide (PubChem CID 131697406) has the molecular formula C16H21N5O5 and a molecular weight of 363.37 g/mol. Its IUPAC name is 3-methoxy-N-[3-(2-methoxyethylcarbamoyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-1,2-oxazole-5-carboxamide.
| Compound Name | 3-methoxy-N-[3-(2-methoxyethylcarbamoyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 131697406 |
| Molecular Formula | C16H21N5O5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 3-methoxy-N-[3-(2-methoxyethylcarbamoyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-1,2-oxazole-5-carboxamide |
| SMILES | COCCNC(=O)c1cnc2n1CC(NC(=O)c1cc(OC)no1)CC2 |
| InChI | InChI=1S/C16H21N5O5/c1-24-6-5-17-15(22)11-8-18-13-4-3-10(9-21(11)13)19-16(23)12-7-14(25-2)20-26-12/h7-8,10H,3-6,9H2,1-2H3,(H,17,22)(H,19,23) |
| InChIKey | IOLGIQUZUFCQQC-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 120.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|