C26H28N6O3 — CID 131697472
(3R,7S)-N-cyclopropyl-4-[2-(2-oxo-1-pyridinyl)acetyl]-7-phenyl-1,4,11,12-tetrazatricyclo[8.3.0.03,7]trideca-10,12-diene-13-carboxamide (PubChem CID 131697472) has the molecular formula C26H28N6O3 and a molecular weight of 472.55 g/mol. Its IUPAC name is (3R,7S)-N-cyclopropyl-4-[2-(2-oxo-1-pyridinyl)acetyl]-7-phenyl-1,4,11,12-tetrazatricyclo[8.3.0.03,7]trideca-10,12-diene-13-carboxamide.
| Compound Name | (3R,7S)-N-cyclopropyl-4-[2-(2-oxo-1-pyridinyl)acetyl]-7-phenyl-1,4,11,12-tetrazatricyclo[8.3.0.03,7]trideca-10,12-diene-13-carboxamide |
|---|---|
| PubChem CID | 131697472 |
| Molecular Formula | C26H28N6O3 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | (3R,7S)-N-cyclopropyl-4-[2-(2-oxo-1-pyridinyl)acetyl]-7-phenyl-1,4,11,12-tetrazatricyclo[8.3.0.03,7]trideca-10,12-diene-13-carboxamide |
| SMILES | O=C(NC1CC1)c1nnc2n1C[C@@H]1N(C(=O)Cn3ccccc3=O)CC[C@]1(c1ccccc1)CC2 |
| InChI | InChI=1S/C26H28N6O3/c33-22-8-4-5-14-30(22)17-23(34)31-15-13-26(18-6-2-1-3-7-18)12-11-21-28-29-24(32(21)16-20(26)31)25(35)27-19-9-10-19/h1-8,14,19-20H,9-13,15-17H2,(H,27,35)/t20-,26-/m0/s1 |
| InChIKey | RDMSBRQTPFENQW-FNZWTVRRSA-N |
| XLogP | 1.52 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |