C21H19NO2 — CID 13169767
(3R,5S)-4-benzyl-3,5-diphenyl-1,2,4-dioxazolidine (PubChem CID 13169767) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is (3R,5S)-4-benzyl-3,5-diphenyl-1,2,4-dioxazolidine.
| Compound Name | (3R,5S)-4-benzyl-3,5-diphenyl-1,2,4-dioxazolidine |
|---|---|
| PubChem CID | 13169767 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (3R,5S)-4-benzyl-3,5-diphenyl-1,2,4-dioxazolidine |
| SMILES | c1ccc(CN2[C@@H](c3ccccc3)OO[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19NO2/c1-4-10-17(11-5-1)16-22-20(18-12-6-2-7-13-18)23-24-21(22)19-14-8-3-9-15-19/h1-15,20-21H,16H2/t20-,21+ |
| InChIKey | GPITZUMLHAPFDR-OYRHEFFESA-N |
| XLogP | 4.85 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|